| Product Name | 5-(2-Thienyl)-pentanoic acid |
| CAS No. | 21010-06-0 |
| Synonyms | 5-(2-Thienyl)pentanoic acid; 5-(2-Thienyl)valeric acid; 5-(thiophen-2-yl)pentanoic acid |
| InChI | InChI=1/C9H12O2S/c10-9(11)6-2-1-4-8-5-3-7-12-8/h3,5,7H,1-2,4,6H2,(H,10,11) |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.2554 |
| Density | 1.182g/cm3 |
| Boiling point | 336.8°C at 760 mmHg |
| Flash point | 157.5°C |
| Refractive index | 1.549 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
21010-06-0 5-(2-thienyl)-pentanoic acid
service@apichina.com