| Product Name | 5-(2-thienyl)nicotinoyl chloride hydrochloride |
| CAS No. | 321309-36-8 |
| Synonyms | 5-thiophen-2-ylpyridine-3-carbonyl chloride hydrochloride; 5-thiophen-2-ylpyridine-3-carbonyl chloride |
| InChI | InChI=1/C10H6ClNOS/c11-10(13)8-4-7(5-12-6-8)9-2-1-3-14-9/h1-6H |
| Molecular Formula | C10H6ClNOS |
| Molecular Weight | 223.6787 |
| Density | 1.365g/cm3 |
| Melting point | 215℃ |
| Boiling point | 366.8°C at 760 mmHg |
| Flash point | 175.6°C |
| Refractive index | 1.62 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
321309-36-8 5-(2-thienyl)nicotinoyl chloride hydrochloride
service@apichina.com