| Product Name | 5-(2-Methylphenyl)-1H-tetrazole |
| CAS No. | 51449-86-6 |
| Synonyms | 5-(o-Tolyl)-1H-tetrazole; 5-(2-methylphenyl)-2H-tetrazole; 5-(2-methylphenyl)tetrazol-1-ide |
| InChI | InChI=1/C8H7N4/c1-6-4-2-3-5-7(6)8-9-11-12-10-8/h2-5H,1H3/q-1 |
| Molecular Formula | C8H7N4 |
| Molecular Weight | 159.1685 |
| Boiling point | 343°C at 760 mmHg |
| Flash point | 164.4°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
51449-86-6 5-(2-methylphenyl)-1h-tetrazole
service@apichina.com