| Product Name | 5-(2-methyl-1,3-thiazol-4-yl)-2-thiophenecarboxylic acid |
| CAS No. | 400715-45-9 |
| Synonyms | 5-(2-Methyl-1,3-thiazol-4-yl)-2- thiophenecarboxylic acid; 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-carboxylic acid |
| InChI | InChI=1/C9H7NO2S2/c1-5-10-6(4-13-5)7-2-3-8(14-7)9(11)12/h2-4H,1H3,(H,11,12) |
| Molecular Formula | C9H7NO2S2 |
| Molecular Weight | 225.2874 |
| Density | 1.446g/cm3 |
| Melting point | 230℃ |
| Boiling point | 434.4°C at 760 mmHg |
| Flash point | 216.5°C |
| Refractive index | 1.659 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
400715-45-9 5-(2-methyl-1,3-thiazol-4-yl)-2-thiophenecarboxylic acid
service@apichina.com