| Product Name | 5-(2-chloroanilino)-3-hydroxyisothiazole-4-carbonitrile |
| CAS No. | 287196-71-8 |
| Synonyms | 5-[(2-chlorophenyl)amino]-3-oxo-2,3-dihydroisothiazole-4-carbonitrile |
| InChI | InChI=1/C10H6ClN3OS/c11-7-3-1-2-4-8(7)13-10-6(5-12)9(15)14-16-10/h1-4,13H,(H,14,15) |
| Molecular Formula | C10H6ClN3OS |
| Molecular Weight | 251.6921 |
| Density | 1.55g/cm3 |
| Melting point | 100℃ |
| Boiling point | 307.8°C at 760 mmHg |
| Flash point | 139.9°C |
| Refractive index | 1.706 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
287196-71-8 5-(2-chloroanilino)-3-hydroxyisothiazole-4-carbonitrile
service@apichina.com