| Product Name | 5-(2,6-dimethylmorpholino)-2-nitrophenol |
| CAS No. | 175135-20-3 |
| Synonyms | 5-(2,6-dimethylmorpholin-4-yl)-2-nitrophenol |
| InChI | InChI=1/C12H16N2O4/c1-8-6-13(7-9(2)18-8)10-3-4-11(14(16)17)12(15)5-10/h3-5,8-9,15H,6-7H2,1-2H3 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.2664 |
| Density | 1.242g/cm3 |
| Melting point | 128℃ |
| Boiling point | 419.4°C at 760 mmHg |
| Flash point | 207.4°C |
| Refractive index | 1.562 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175135-20-3 5-(2,6-dimethylmorpholino)-2-nitrophenol
service@apichina.com