| Product Name | 5-(2,5-Dichlorophenyl)-1H-tetrazole |
| CAS No. | 98555-71-6 |
| Synonyms | 5-(2,5-dichlorophenyl)-2H-tetrazole |
| InChI | InChI=1/C7H4Cl2N4/c8-4-1-2-6(9)5(3-4)7-10-12-13-11-7/h1-3H,(H,10,11,12,13) |
| Molecular Formula | C7H4Cl2N4 |
| Molecular Weight | 215.0395 |
| Density | 1.574g/cm3 |
| Boiling point | 401.9°C at 760 mmHg |
| Flash point | 229.1°C |
| Refractive index | 1.641 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
98555-71-6 5-(2,5-dichlorophenyl)-1h-tetrazole
service@apichina.com