| Product Name | 5-(1,4-diazepan-1-yl)-3-phenyl-1,2,4-thiadiazole |
| CAS No. | 306934-71-4 |
| Synonyms | 1-(3-phenyl-1,2,4-thiadiazol-5-yl)-1,4-diazepane |
| InChI | InChI=1/C13H16N4S/c1-2-5-11(6-3-1)12-15-13(18-16-12)17-9-4-7-14-8-10-17/h1-3,5-6,14H,4,7-10H2 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.3579 |
| Density | 1.201g/cm3 |
| Melting point | 79℃ |
| Boiling point | 428.3°C at 760 mmHg |
| Flash point | 212.8°C |
| Refractive index | 1.594 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
306934-71-4 5-(1,4-diazepan-1-yl)-3-phenyl-1,2,4-thiadiazole
service@apichina.com