| Product Name | 4-(Trifluoromethylsulfonyl)benzonitrile |
| CAS No. | 312-21-0 |
| Synonyms | 4-Cyanophenyl trifluoromethyl sulphone; 4-(Trifluoromethylsulphonyl)benzonitrile; 4-(Trifluoromethanesulfonyl)benzonitrile |
| InChI | InChI=1/C6H4FNO/c7-5-2-1-3-8-6(5)4-9/h1-4H |
| Molecular Formula | C6H4FNO |
| Molecular Weight | 125.1005 |
| Density | 1.269g/cm3 |
| Melting point | 84-88℃ |
| Boiling point | 166.5°C at 760 mmHg |
| Flash point | 54.5°C |
| Refractive index | 1.543 |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
312-21-0 4-(trifluoromethylsulfonyl)benzonitrile
service@apichina.com