| Product Name | 4-sec-Butylaniline |
| CAS No. | 30273-11-1 |
| Synonyms | benzenamine, 4-(1-methylpropyl)-; p-sec-Butylaniline; 4-(butan-2-yl)aniline; N-(1-methylpropyl)-benzenamine |
| InChI | InChI=1/C10H15N/c1-3-8(2)9-4-6-10(11)7-5-9/h4-8H,3,11H2,1-2H3 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.2328 |
| Density | 0.942g/cm3 |
| Boiling point | 244.2°C at 760 mmHg |
| Flash point | 107.8°C |
| Refractive index | 1.535 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
30273-11-1 4-sec-butylaniline
service@apichina.com