| Product Name | 4-Pyridylthiourea |
| CAS No. | 164670-44-4 |
| Synonyms | 1-pyridin-4-ylthiourea |
| InChI | InChI=1/C6H7N3S/c7-6(10)9-5-1-3-8-4-2-5/h1-4H,(H3,7,8,9,10) |
| Molecular Formula | C6H7N3S |
| Molecular Weight | 153.2049 |
| Density | 1.382g/cm3 |
| Melting point | 181℃ |
| Boiling point | 298.7°C at 760 mmHg |
| Flash point | 134.4°C |
| Refractive index | 1.742 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
164670-44-4 4-pyridylthiourea
service@apichina.com