| Product Name | (4-Pyridyl)acetone |
| CAS No. | 6304-16-1 |
| Synonyms | 1-(4-Pyridyl)-2-propanone; 1-(pyridin-4-yl)propan-2-one; 1-(4-Pyridyl)-2-acetone; 1-(4-Pyridyl)acetone; 4-Pyridyl acetone |
| InChI | InChI=1/C8H9NO/c1-7(10)6-8-2-4-9-5-3-8/h2-5H,6H2,1H3 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.1632 |
| Density | 1.047g/cm3 |
| Boiling point | 232.523°C at 760 mmHg |
| Flash point | 100.06°C |
| Refractive index | 1.509 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6304-16-1 (4-pyridyl)acetone
service@apichina.com