| Product Name | 4-Piperazinoacetophenone |
| CAS No. | 51639-48-6 |
| Synonyms | piperazin-4-ylacetophenone; 1-[4-(piperazin-1-yl)phenyl]ethanone; 1-phenyl-2-piperazin-1-ylethanone; 4-(4-acetylphenyl)piperazin-1-ium; 4'-poperazinoacetophenone; 4'-Piperazinoacetophenone |
| InChI | InChI=1/C12H16N2O/c1-10(15)11-2-4-12(5-3-11)14-8-6-13-7-9-14/h2-5,13H,6-9H2,1H3/p+1 |
| Molecular Formula | C12H17N2O |
| Molecular Weight | 205.2756 |
| Melting point | 107-112℃ |
| Boiling point | 382.4°C at 760 mmHg |
| Flash point | 185.1°C |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
51639-48-6 4-piperazinoacetophenone
service@apichina.com