| Product Name | 4-Phenylazophenyl isothiocyanate |
| CAS No. | 7612-96-6 |
| Synonyms | 4-Isothiocyanatoazobenzene; (E)-1-(4-isothiocyanatophenyl)-2-phenyldiazene |
| InChI | InChI=1/C13H9N3S/c17-10-14-11-6-8-13(9-7-11)16-15-12-4-2-1-3-5-12/h1-9H/b16-15+ |
| Molecular Formula | C13H9N3S |
| Molecular Weight | 239.2957 |
| Density | 1.15g/cm3 |
| Boiling point | 402.4°C at 760 mmHg |
| Flash point | 211.3°C |
| Refractive index | 1.629 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
7612-96-6 4-phenylazophenyl isothiocyanate
service@apichina.com