| Product Name | 4-phenylazomaleinanil |
| CAS No. | 16201-96-0 |
| Synonyms | 4-(N-Maleimido)azobenzene; 1-[4-(Phenylazo)-phenyl]-1H-pyrrole-2,5-dione; 1-{4-[(E)-phenyldiazenyl]phenyl}-1H-pyrrole-2,5-dione |
| InChI | InChI=1/C16H11N3O2/c20-15-10-11-16(21)19(15)14-8-6-13(7-9-14)18-17-12-4-2-1-3-5-12/h1-11H/b18-17+ |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.2774 |
| Density | 1.26g/cm3 |
| Melting point | 162-165℃ |
| Boiling point | 475.1°C at 760 mmHg |
| Flash point | 241.1°C |
| Refractive index | 1.653 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
16201-96-0 4-phenylazomaleinanil
service@apichina.com