| Product Name | 4-phenyl-1,2,3-thiadiazole-5-carboxylic acid |
| CAS No. | 78875-63-5 |
| InChI | InChI=1/C9H6N2O2S/c12-9(13)8-7(10-11-14-8)6-4-2-1-3-5-6/h1-5H,(H,12,13) |
| Molecular Formula | C9H6N2O2S |
| Molecular Weight | 206.2211 |
| Density | 1.44g/cm3 |
| Melting point | 150℃ |
| Boiling point | 380°C at 760 mmHg |
| Flash point | 183.6°C |
| Refractive index | 1.651 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
78875-63-5 4-phenyl-1,2,3-thiadiazole-5-carboxylic acid
service@apichina.com