| Product Name | 4-phenoxyphenyl isocyanate |
| CAS No. | 59377-19-4 |
| Synonyms | 4-Isocyanatodiphenyl ether; 1-isocyanato-4-phenoxybenzene |
| InChI | InChI=1/C13H9NO2/c15-10-14-11-6-8-13(9-7-11)16-12-4-2-1-3-5-12/h1-9H |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.2161 |
| Density | 1.09g/cm3 |
| Boiling point | 307.4°C at 760 mmHg |
| Flash point | 136°C |
| Refractive index | 1.561 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
59377-19-4 4-phenoxyphenyl isocyanate
service@apichina.com