| Product Name | 4-Phenoxybutyryl chloride |
| CAS No. | 5139-89-9 |
| Synonyms | 4-phenoxybutanoyl chloride |
| InChI | InChI=1/C10H11ClO2/c11-10(12)7-4-8-13-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.6461 |
| Density | 1.158g/cm3 |
| Boiling point | 297.1°C at 760 mmHg |
| Flash point | 110.6°C |
| Refractive index | 1.515 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
5139-89-9 4-phenoxybutyryl chloride
service@apichina.com