| Product Name | 4-phenoxybutyric acid |
| CAS No. | 6303-58-8 |
| Synonyms | Phenoxybutyricacid,97%; 4-phenoxybutanoic acid |
| InChI | InChI=1/C10H12O3/c11-10(12)7-4-8-13-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,11,12) |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2005 |
| Density | 1.143g/cm3 |
| Melting point | 63-65℃ |
| Boiling point | 349.6°C at 760 mmHg |
| Flash point | 140.5°C |
| Refractive index | 1.526 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:; S24/25:; |
6303-58-8 4-phenoxybutyric acid
service@apichina.com