| Product Name | 4-Pentylbenzoyl chloride |
| CAS No. | 49763-65-7 |
| Synonyms | 4-n-Amylbenzoyl chloride; Benzoyl chloride, 4-pentyl- |
| InChI | InChI=1/C12H15ClO/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9H,2-5H2,1H3 |
| Molecular Formula | C12H15ClO |
| Molecular Weight | 210.6999 |
| Density | 1.063g/cm3 |
| Boiling point | 288.4°C at 760 mmHg |
| Flash point | 130.3°C |
| Refractive index | 1.516 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
49763-65-7 4-pentylbenzoyl chloride
service@apichina.com