| Product Name | 4-pentylbenzonitrile |
| CAS No. | 10270-29-8 |
| InChI | InChI=1/C12H15N/c1-2-3-4-5-11-6-8-12(10-13)9-7-11/h6-9H,2-5H2,1H3 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.2542 |
| Density | 0.95g/cm3 |
| Boiling point | 278.9°C at 760 mmHg |
| Flash point | 122.7°C |
| Refractive index | 1.51 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
10270-29-8 4-pentylbenzonitrile
service@apichina.com