| Product Name | 4-Penten-1-yl acetate |
| CAS No. | 1576-85-8 |
| Synonyms | 5-Acetoxy-1-pentene; pent-4-ene-1-yl acetate; Acetic Acid 4-Penten-1-yl Ester; pent-4-en-1-yl acetate |
| InChI | InChI=1/C7H12O2/c1-3-4-5-6-9-7(2)8/h3H,1,4-6H2,2H3 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.169 |
| Density | 0.898g/cm3 |
| Boiling point | 145°C at 760 mmHg |
| Flash point | 45.6°C |
| Refractive index | 1.418 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
1576-85-8 4-penten-1-yl acetate
service@apichina.com