| Product Name | 4-oxohepta-2,5-dienedioic acid |
| CAS No. | 34911-62-1 |
| Synonyms | (2E,5E)-4-oxohepta-2,5-dienedioic acid |
| InChI | InChI=1/C7H6O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H,(H,9,10)(H,11,12)/b3-1+,4-2+ |
| Molecular Formula | C7H6O5 |
| Molecular Weight | 170.1195 |
| Density | 1.445g/cm3 |
| Melting point | 300℃ |
| Boiling point | 406.9°C at 760 mmHg |
| Flash point | 214.1°C |
| Refractive index | 1.554 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
34911-62-1 4-oxohepta-2,5-dienedioic acid
service@apichina.com