| Product Name | 4-oxo-4-(4-propylphenyl)butanoic acid |
| CAS No. | 57821-78-0 |
| InChI | InChI=1/C13H16O3/c1-2-3-10-4-6-11(7-5-10)12(14)8-9-13(15)16/h4-7H,2-3,8-9H2,1H3,(H,15,16) |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.2643 |
| Density | 1.112g/cm3 |
| Melting point | 117℃ |
| Boiling point | 408.3°C at 760 mmHg |
| Flash point | 214.9°C |
| Refractive index | 1.531 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
57821-78-0 4-oxo-4-(4-propylphenyl)butanoic acid
service@apichina.com