| Product Name | 4-oxo-4-(4-propoxyphenyl)butanoic acid |
| CAS No. | 39496-82-7 |
| InChI | InChI=1/C13H16O4/c1-2-9-17-11-5-3-10(4-6-11)12(14)7-8-13(15)16/h3-6H,2,7-9H2,1H3,(H,15,16) |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.2637 |
| Density | 1.149g/cm3 |
| Boiling point | 435°C at 760 mmHg |
| Flash point | 166.4°C |
| Refractive index | 1.525 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
39496-82-7 4-oxo-4-(4-propoxyphenyl)butanoic acid
service@apichina.com