| Product Name | 4-Oxo-4-((2-phenylethyl)amino)-2-butanesulfinic acid compd. with benze neethanamine (1:1) |
| CAS No. | 171359-14-1 |
| Synonyms | 2-Butanesulfinic acid, 4-oxo-4-((2-phenylethyl)amino)-, compd. with benzeneethanamine (1:1); 2-Phenylethylammonium salt of the 2-phenylethylamide of beta-sulfinobutyric acid; 4-Oxo-4-((2-phenylethyl)amino)-2-butanesulfinic acid compd. with benzeneethanamine (1:1); Benzeneethanamine, 4-oxo-4-((2-phenylethyl)amino)-2-butanesulfinate; 4-oxo-4-[(2-phenylethyl)amino]butane-2-sulfinic acid - 2-phenylethanamine (1:1) |
| InChI | InChI=1/C12H17NO3S.C8H11N/c1-10(17(15)16)9-12(14)13-8-7-11-5-3-2-4-6-11;9-7-6-8-4-2-1-3-5-8/h2-6,10H,7-9H2,1H3,(H,13,14)(H,15,16);1-5H,6-7,9H2 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.5129 |
| Boiling point | 654.2°C at 760 mmHg |
| Flash point | 349.5°C |
171359-14-1 4-oxo-4-((2-phenylethyl)amino)-2-butanesulfinic acid compd. with benze neethanamine (1:1
service@apichina.com