| Product Name | 4-oxo-4-(2-oxo-1,2-diphenylethoxy)butanoic acid |
| CAS No. | 306935-85-3 |
| Synonyms | 4-Oxo-4-(2-oxo-1,2-diphenylethoxy)butanoicacid |
| InChI | InChI=1/C18H16O5/c19-15(20)11-12-16(21)23-18(14-9-5-2-6-10-14)17(22)13-7-3-1-4-8-13/h1-10,18H,11-12H2,(H,19,20) |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.3166 |
| Density | 1.266g/cm3 |
| Boiling point | 513.8°C at 760 mmHg |
| Flash point | 187.6°C |
| Refractive index | 1.585 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
306935-85-3 4-oxo-4-(2-oxo-1,2-diphenylethoxy)butanoic acid
service@apichina.com