| Product Name | 4-octanol |
| CAS No. | 589-62-8 |
| Synonyms | n-Butyl n-propyl carbinol; octan-4-ol |
| InChI | InChI=1/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 |
| Molecular Formula | C8H18O |
| Molecular Weight | 130.2279 |
| Density | 0.821g/cm3 |
| Boiling point | 179.2°C at 760 mmHg |
| Flash point | 71.1°C |
| Refractive index | 1.426 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
589-62-8 4-octanol
service@apichina.com