| Product Name | 4-o-tolylazo-o-toluidinium chloride |
| CAS No. | 2298-13-7 |
| Synonyms | C.I. Solvent Yellow 3 monohydrochloride; C.I. Solvent Yellow 3, monohydrochloride (8CI); 4-Amino-2,3-dimethylazobenzene hydrochloride; p-Amino-2,3-azotoluene hydrochloride~C.I. 37210~Fast Garnet GBC hydrochloride; 2-methyl-4-[(E)-(2-methylphenyl)diazenyl]aniline hydrochloride (1:1) |
| InChI | InChI=1/C14H15N3.ClH/c1-10-5-3-4-6-14(10)17-16-12-7-8-13(15)11(2)9-12;/h3-9H,15H2,1-2H3;1H/b17-16+; |
| Molecular Formula | C14H16ClN3 |
| Molecular Weight | 261.7499 |
| Boiling point | 407.7°C at 760 mmHg |
| Flash point | 200.4°C |
| Risk Codes | R40:Possible risks of irreversible effects.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
2298-13-7 4-o-tolylazo-o-toluidinium chloride
service@apichina.com