| Product Name | 4-nonyl phenol |
| CAS No. | 84852-15-3 |
| Synonyms | Branched p-nonylphenol; C9 branched alkyl phenol; p-Nonylphenol; p-Nonylphenol, branched; Phenol,4-nonyl-,branched; 4-(7-methyloctyl)phenol |
| InChI | InChI=1/C15H24O/c1-13(2)7-5-3-4-6-8-14-9-11-15(16)12-10-14/h9-13,16H,3-8H2,1-2H3 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.3505 |
| Density | 0.931g/cm3 |
| Boiling point | 325.3°C at 760 mmHg |
| Flash point | 167.8°C |
| Water solubility | 5g/L |
| Refractive index | 1.504 |
| Hazard Symbols |  C:Corrosive;  N:Dangerous for the environment; |
| Risk Codes | R22:Harmful if swallowed.; R34:Causes burns.; R50/53:Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S60:This material and its container must be disposed of as hazardous waste.; S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
84852-15-3 4-nonyl phenol
service@apichina.com