| Product Name | 4-Nitrophenylsuccinic acid |
| CAS No. | 21021-53-4 |
| Synonyms | 2-(4-nitrophenyl)butanedioic acid; (2R)-2-(4-nitrophenyl)butanedioate; (2S)-2-(4-nitrophenyl)butanedioate |
| InChI | InChI=1/C10H9NO6/c12-9(13)5-8(10(14)15)6-1-3-7(4-2-6)11(16)17/h1-4,8H,5H2,(H,12,13)(H,14,15)/p-2/t8-/m0/s1 |
| Molecular Formula | C10H7NO6 |
| Molecular Weight | 237.1668 |
| Melting point | 216-218℃ |
| Boiling point | 404.8°C at 760 mmHg |
| Flash point | 175.9°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
21021-53-4 4-nitrophenylsuccinic acid
service@apichina.com