| Product Name | 4-Nitrophenylglyoxylic acid |
| CAS No. | 14922-36-2 |
| Synonyms | 4-Nitrobenzoylformic acid; (4-nitrophenyl)(oxo)acetic acid |
| InChI | InChI=1/C8H5NO5/c10-7(8(11)12)5-1-3-6(4-2-5)9(13)14/h1-4H,(H,11,12) |
| Molecular Formula | C8H5NO5 |
| Molecular Weight | 195.129 |
| Density | 1.531g/cm3 |
| Boiling point | 381.6°C at 760 mmHg |
| Flash point | 173.1°C |
| Refractive index | 1.613 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
14922-36-2 4-nitrophenylglyoxylic acid
service@apichina.com