| Product Name | 4-Nitrophenyl phenyl ether |
| CAS No. | 620-88-2 |
| Synonyms | p-Nitrodiphenyl ether; P-NITRODIPHENYLETHER; 1-nitro-4-phenoxybenzene; methyl 2-[(chloroacetyl)amino]benzoate; 2-chloro-N-(2-fluorophenyl)acetamide; 2-chloro-1-[2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrol-3-yl]ethanone |
| InChI | InChI=1/C15H16ClNO/c1-10-4-6-13(7-5-10)17-11(2)8-14(12(17)3)15(18)9-16/h4-8H,9H2,1-3H3 |
| Molecular Formula | C15H16ClNO |
| Molecular Weight | 261.7466 |
| Density | 1.12g/cm3 |
| Melting point | 53-56℃ |
| Boiling point | 399.6°C at 760 mmHg |
| Flash point | 195.4°C |
| Refractive index | 1.564 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
620-88-2 4-nitrophenyl phenyl ether
service@apichina.com