| Product Name | 4-Nitrophenyl chloroacetate |
| CAS No. | 777-84-4;79328-69-1 |
| Synonyms | AI3-23373; Acetic acid, chloro-, 4-nitrophenyl ester |
| InChI | InChI=1/C8H6ClNO4/c9-5-8(11)14-7-3-1-6(2-4-7)10(12)13/h1-4H,5H2 |
| Molecular Formula | C8H6ClNO4 |
| Molecular Weight | 215.5905 |
| Density | 1.434g/cm3 |
| Melting point | 73-75℃ |
| Boiling point | 334.5°C at 760 mmHg |
| Flash point | 156.1°C |
| Refractive index | 1.565 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
777-84-4;79328-69-1 4-nitrophenyl chloroacetate
service@apichina.com