| Product Name | 4-nitrophenyl caprylate |
| CAS No. | 1956-10-1 |
| Synonyms | Caprylic acid 4-nitrophenyl ester~4-Nitrophenyl octanoate~Octanoic acid 4-nitrophenyl ester; 4-Nitrophenyl octanoate |
| InChI | InChI=1/C14H19NO4/c1-2-3-4-5-6-7-14(16)19-13-10-8-12(9-11-13)15(17)18/h8-11H,2-7H2,1H3 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.305 |
| Density | 1.115g/cm3 |
| Boiling point | 378.7°C at 760 mmHg |
| Flash point | 149.1°C |
| Refractive index | 1.516 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
1956-10-1 4-nitrophenyl caprylate
service@apichina.com