| Product Name | 4-Nitrophenoxyacetic acid hydrazide |
| CAS No. | 75129-74-7 |
| Synonyms | Acetic acid, (4-nitrophenoxy)-, hydrazide; 2-(4-nitrophenoxy)acetohydrazide |
| InChI | InChI=1/C8H9N3O4/c9-10-8(12)5-15-7-3-1-6(2-4-7)11(13)14/h1-4H,5,9H2,(H,10,12) |
| Molecular Formula | C8H9N3O4 |
| Molecular Weight | 211.1748 |
| Density | 1.394g/cm3 |
| Boiling point | 511.9°C at 760 mmHg |
| Flash point | 263.4°C |
| Refractive index | 1.592 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
75129-74-7 4-nitrophenoxyacetic acid hydrazide
service@apichina.com