| Product Name | 4-Nitronicotinic acid N-oxide |
| CAS No. | 1078-05-3 |
| Synonyms | 4-Nitropyridine-3-carboxylic acid N-oxide; 4-nitropyridine-3-carboxylic acid 1-oxide |
| InChI | InChI=1/C6H4N2O5/c9-6(10)4-3-7(11)2-1-5(4)8(12)13/h1-3H,(H,9,10) |
| Molecular Formula | C6H4N2O5 |
| Molecular Weight | 184.1064 |
| Density | 1.69g/cm3 |
| Boiling point | 553.6°C at 760 mmHg |
| Flash point | 288.6°C |
| Refractive index | 1.653 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1078-05-3 4-nitronicotinic acid n-oxide
service@apichina.com