| Product Name | 4-Nitrocinnamyl alcohol |
| CAS No. | 1504-63-8 |
| Synonyms | 2-Propen-1-ol, 3-(4-nitrophenyl)-; 2-Propen-1-ol, 3-(p-nitrophenyl)-; 3-(4-nitrophenyl)prop-2-en-1-ol; (2E)-3-(4-nitrophenyl)prop-2-en-1-ol |
| InChI | InChI=1/C9H9NO3/c11-7-1-2-8-3-5-9(6-4-8)10(12)13/h1-6,11H,7H2/b2-1+ |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.1727 |
| Density | 1.282g/cm3 |
| Melting point | 127-128℃ |
| Boiling point | 325.3°C at 760 mmHg |
| Flash point | 144.1°C |
| Refractive index | 1.637 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1504-63-8 4-nitrocinnamyl alcohol
service@apichina.com