| Product Name | 4-Nitrobenzyl bromoacetate |
| CAS No. | 16869-24-2 |
| Synonyms | Bromoacetic acid 4-nitrobenzyl ester |
| InChI | InChI=1/C9H8BrNO4/c10-5-9(12)15-6-7-1-3-8(4-2-7)11(13)14/h1-4H,5-6H2 |
| Molecular Formula | C9H8BrNO4 |
| Molecular Weight | 274.0681 |
| Density | 1.638g/cm3 |
| Boiling point | 368.5°C at 760 mmHg |
| Flash point | 176.7°C |
| Refractive index | 1.59 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
16869-24-2 4-nitrobenzyl bromoacetate
service@apichina.com