| Product Name | 4-Nitro-1-Naphthol |
| CAS No. | 605-62-9 |
| Synonyms | 4-nitronaphthalen-1-ol |
| InChI | InChI=1/C10H7NO3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,12H |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.1675 |
| Density | 1.413g/cm3 |
| Boiling point | 398.8°C at 760 mmHg |
| Flash point | 179.8°C |
| Refractive index | 1.714 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
605-62-9 4-nitro-1-naphthol
service@apichina.com