| Product Name | 4-n-Pentylbenzeneboronic acid |
| CAS No. | 121219-12-3 |
| Synonyms | 4-n-Amylbenzeneboronic acid; 4-n-Pentylphenylboronic acid; (4-pentylphenyl)boronic acid; 4-Pentylbenzeneboronic acid |
| InChI | InChI=1/C11H17BO2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9,13-14H,2-5H2,1H3 |
| Molecular Formula | C11H17BO2 |
| Molecular Weight | 192.0625 |
| Density | 1.01g/cm3 |
| Boiling point | 328°C at 760 mmHg |
| Flash point | 152.2°C |
| Refractive index | 1.509 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
121219-12-3 4-n-pentylbenzeneboronic acid
service@apichina.com