| Product Name | 4-n-Nonylphenol |
| CAS No. | 104-40-5 |
| Synonyms | 1-(4-Hydroxyphenyl)nonane; 4-nonylphenol; 2-nonylphenol |
| InChI | InChI=1/C15H24O/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16/h9-10,12-13,16H,2-8,11H2,1H3 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.3505 |
| Density | 0.932g/cm3 |
| Boiling point | 321.3°C at 760 mmHg |
| Flash point | 177.5°C |
| Refractive index | 1.505 |
| Risk Codes | R22:Harmful if swallowed.; R34:Causes burns.; R52/53:Harmful to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
104-40-5 4-n-nonylphenol
service@apichina.com