| Product Name | 4-n-Nonylbenzeneboronic acid |
| CAS No. | 256383-45-6 |
| Synonyms | 4-Nonylphenylboronicacid; (4-nonylphenyl)boronic acid; 4-N-Nonylphenylboronicacid |
| InChI | InChI=1/C15H25BO2/c1-2-3-4-5-6-7-8-9-14-10-12-15(13-11-14)16(17)18/h10-13,17-18H,2-9H2,1H3 |
| Molecular Formula | C15H25BO2 |
| Molecular Weight | 248.1688 |
| Density | 0.97g/cm3 |
| Boiling point | 385.3°C at 760 mmHg |
| Flash point | 186.8°C |
| Refractive index | 1.501 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
256383-45-6 4-n-nonylbenzeneboronic acid
service@apichina.com