| Product Name | 4-n-Dodecylresorcinol |
| CAS No. | 24305-56-4 |
| Synonyms | 4-Dodecylresorcinol; 4-dodecylbenzene-1,3-diol |
| InChI | InChI=1/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-16-13-14-17(19)15-18(16)20/h13-15,19-20H,2-12H2,1H3 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.4296 |
| Density | 0.979g/cm3 |
| Melting point | 78-83℃ |
| Boiling point | 393°C at 760 mmHg |
| Flash point | 184.1°C |
| Refractive index | 1.516 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
24305-56-4 4-n-dodecylresorcinol
service@apichina.com