| Product Name | 4-n-Butylbenzeneboronic acid |
| CAS No. | 145240-28-4 |
| Synonyms | 4-n-Butylphenylboronic acid; 4-Butylphenylboronic acid; (4-butylphenyl)boronic acid |
| InChI | InChI=1/C10H15BO2/c1-2-3-4-9-5-7-10(8-6-9)11(12)13/h5-8,12-13H,2-4H2,1H3 |
| Molecular Formula | C10H15BO2 |
| Molecular Weight | 178.0359 |
| Density | 1.03g/cm3 |
| Melting point | 91-97℃ |
| Boiling point | 313.5°C at 760 mmHg |
| Flash point | 143.4°C |
| Refractive index | 1.512 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
145240-28-4 4-n-butylbenzeneboronic acid
service@apichina.com