| Product Name | 4-n-Butoxybenzoyl chloride |
| CAS No. | 33863-86-4 |
| Synonyms | 4-Butoxybenzoyl chloride |
| InChI | InChI=1/C11H13ClO2/c1-2-3-8-14-10-6-4-9(5-7-10)11(12)13/h4-7H,2-3,8H2,1H3 |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.6727 |
| Density | 1.123g/cm3 |
| Boiling point | 309.2°C at 760 mmHg |
| Flash point | 115°C |
| Refractive index | 1.514 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
33863-86-4 4-n-butoxybenzoyl chloride
service@apichina.com