| Product Name | (4-morpholinophenyl)methanol |
| CAS No. | 280556-71-0 |
| Synonyms | (4-Morpholin-4-yl-phenyl)-methanol |
| InChI | InChI=1/C11H15NO2/c13-9-10-1-3-11(4-2-10)12-5-7-14-8-6-12/h1-4,13H,5-9H2 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.2423 |
| Density | 1.16g/cm3 |
| Boiling point | 378.4°C at 760 mmHg |
| Flash point | 182.7°C |
| Refractive index | 1.568 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
280556-71-0 (4-morpholinophenyl)methanol
service@apichina.com