| Product Name | 4-morpholinophenyl isothiocyanate |
| CAS No. | 51317-66-9 |
| Synonyms | 4-(4-isothiocyanatophenyl)morpholine |
| InChI | InChI=1/C11H12N2OS/c15-9-12-10-1-3-11(4-2-10)13-5-7-14-8-6-13/h1-4H,5-8H2 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.2908 |
| Density | 1.2g/cm3 |
| Boiling point | 394.4°C at 760 mmHg |
| Flash point | 192.3°C |
| Refractive index | 1.613 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
51317-66-9 4-morpholinophenyl isothiocyanate
service@apichina.com