| Product Name | [4-(Morpholinomethyl)phenyl]methanol |
| CAS No. | 91271-65-7 |
| Synonyms | [4-(morpholin-4-ylmethyl)phenyl]methanol |
| InChI | InChI=1/C12H17NO2/c14-10-12-3-1-11(2-4-12)9-13-5-7-15-8-6-13/h1-4,14H,5-10H2 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.2689 |
| Density | 1.147g/cm3 |
| Melting point | 94℃ |
| Boiling point | 337.3°C at 760 mmHg |
| Flash point | 157.8°C |
| Refractive index | 1.569 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
91271-65-7 [4-(morpholinomethyl)phenyl]methanol
service@apichina.com