| Product Name | 4-(Morpholinomethyl)benzoic acid |
| CAS No. | 62642-62-0 |
| Synonyms | 4-(morpholin-4-ylmethyl)benzoic acid |
| InChI | InChI=1/C12H15NO3/c14-12(15)11-3-1-10(2-4-11)9-13-5-7-16-8-6-13/h1-4H,5-9H2,(H,14,15) |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.2524 |
| Density | 1.233g/cm3 |
| Melting point | 179℃ |
| Boiling point | 369.8°C at 760 mmHg |
| Flash point | 177.4°C |
| Refractive index | 1.58 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
62642-62-0 4-(morpholinomethyl)benzoic acid
service@apichina.com